C16H20N4O3+2 — CID 72542341
1-[[2-(ethoxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide (PubChem CID 72542341) has the molecular formula C16H20N4O3+2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[[2-(ethoxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-[[2-(ethoxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 72542341 |
| Molecular Formula | C16H20N4O3+2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[[2-(ethoxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide |
| SMILES | CCON=Cc1cccc[n+]1COC[n+]1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H19N4O3/c1-2-23-18-11-15-5-3-4-8-20(15)13-22-12-19-9-6-14(7-10-19)16(17)21/h3-11H,2,12-13H2,1H3,(H-,17,21)/q+1/p+1 |
| InChIKey | HHVGAVAKIVJKIZ-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|