C14H16Cl2N4O3 — CID 135525271
1-[[2-[(E)-hydroxyiminomethyl]-6-tritiopyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride (PubChem CID 135525271) has the molecular formula C14H16Cl2N4O3 and a molecular weight of 361.22 g/mol. Its IUPAC name is 1-[[2-[(E)-hydroxyiminomethyl]-6-tritiopyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride.
| Compound Name | 1-[[2-[(E)-hydroxyiminomethyl]-6-tritiopyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride |
|---|---|
| PubChem CID | 135525271 |
| Molecular Formula | C14H16Cl2N4O3 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-[[2-[(E)-hydroxyiminomethyl]-6-tritiopyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-carboxamide dichloride |
| SMILES | [3H]c1cccc(/C=N/O)[n+]1COC[n+]1ccc(C(N)=O)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C14H14N4O3.2ClH/c15-14(19)12-4-7-17(8-5-12)10-21-11-18-6-2-1-3-13(18)9-16-20;;/h1-9H,10-11H2,(H-,15,19);2*1H/i6T;; |
| InChIKey | QELSIJXWEROXOE-JFCUDOESSA-N |
| XLogP | -6.19 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | -6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|