C21H21N3O3+2 — CID 173451304
[1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-3-yl]-(4-methylphenyl)methanone (PubChem CID 173451304) has the molecular formula C21H21N3O3+2 and a molecular weight of 363.42 g/mol. Its IUPAC name is [1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-3-yl]-(4-methylphenyl)methanone.
| Compound Name | [1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-3-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 173451304 |
| Molecular Formula | C21H21N3O3+2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-3-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc[n+](COC[n+]3ccccc3C=NO)c2)cc1 |
| InChI | InChI=1S/C21H20N3O3/c1-17-7-9-18(10-8-17)21(25)19-5-4-11-23(14-19)15-27-16-24-12-3-2-6-20(24)13-22-26/h2-14H,15-16H2,1H3/q+1/p+1 |
| InChIKey | WNCIPYDRQONPTB-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|