C18H23I2N3O3 — CID 135770300
1-[1-[[2-[(Z)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]-2,2-dimethylpropan-1-one diiodide (PubChem CID 135770300) has the molecular formula C18H23I2N3O3 and a molecular weight of 583.21 g/mol. Its IUPAC name is 1-[1-[[2-[(Z)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]-2,2-dimethylpropan-1-one diiodide.
| Compound Name | 1-[1-[[2-[(Z)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]-2,2-dimethylpropan-1-one diiodide |
|---|---|
| PubChem CID | 135770300 |
| Molecular Formula | C18H23I2N3O3 |
| Molecular Weight | 583.21 g/mol |
| Exact Mass | 582.98 |
| IUPAC Name | 1-[1-[[2-[(Z)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]-2,2-dimethylpropan-1-one diiodide |
| SMILES | CC(C)(C)C(=O)c1cc[n+](COC[n+]2ccccc2/C=N\O)cc1.[I-].[I-] |
| InChI | InChI=1S/C18H22N3O3.2HI/c1-18(2,3)17(22)15-7-10-20(11-8-15)13-24-14-21-9-5-4-6-16(21)12-19-23;;/h4-12H,13-14H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | LLBCENNWMKCUGW-UHFFFAOYSA-M |
| XLogP | -4.06 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.21 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|