C15H24N2O3Si — CID 140848670
N-(2-isocyanoethyl)-N-(3-trimethoxysilylpropyl)aniline (PubChem CID 140848670) has the molecular formula C15H24N2O3Si and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(2-isocyanoethyl)-N-(3-trimethoxysilylpropyl)aniline.
| Compound Name | N-(2-isocyanoethyl)-N-(3-trimethoxysilylpropyl)aniline |
|---|---|
| PubChem CID | 140848670 |
| Molecular Formula | C15H24N2O3Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-(2-isocyanoethyl)-N-(3-trimethoxysilylpropyl)aniline |
| SMILES | [C-]#[N+]CCN(CCC[Si](OC)(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O3Si/c1-16-11-13-17(15-9-6-5-7-10-15)12-8-14-21(18-2,19-3)20-4/h5-7,9-10H,8,11-14H2,2-4H3 |
| InChIKey | QPIYWHWJJFFEGL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|