C18H24N2O7SSi — CID 90145322
2-nitro-N-phenyl-N-(3-trimethoxysilylpropyl)benzenesulfonamide (PubChem CID 90145322) has the molecular formula C18H24N2O7SSi and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-nitro-N-phenyl-N-(3-trimethoxysilylpropyl)benzenesulfonamide.
| Compound Name | 2-nitro-N-phenyl-N-(3-trimethoxysilylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90145322 |
| Molecular Formula | C18H24N2O7SSi |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-nitro-N-phenyl-N-(3-trimethoxysilylpropyl)benzenesulfonamide |
| SMILES | CO[Si](CCCN(c1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-])(OC)OC |
| InChI | InChI=1S/C18H24N2O7SSi/c1-25-29(26-2,27-3)15-9-14-19(16-10-5-4-6-11-16)28(23,24)18-13-8-7-12-17(18)20(21)22/h4-8,10-13H,9,14-15H2,1-3H3 |
| InChIKey | XZPSKSYXZHIMBZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|