C16H18F13N2+ — CID 102097482
1-butyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)imidazol-3-ium (PubChem CID 102097482) has the molecular formula C16H18F13N2+ and a molecular weight of 485.31 g/mol. Its IUPAC name is 1-butyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)imidazol-3-ium.
| Compound Name | 1-butyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)imidazol-3-ium |
|---|---|
| PubChem CID | 102097482 |
| Molecular Formula | C16H18F13N2+ |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-butyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)imidazol-3-ium |
| SMILES | CCCCn1cc[n+](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F13N2/c1-2-3-6-30-8-9-31(10-30)7-4-5-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h8-10H,2-7H2,1H3/q+1 |
| InChIKey | VASHUXAIUQUXCG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|