C9H14O4 — CID 19107179
7-ethoxyheptane-2,4,5-trione (PubChem CID 19107179) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-ethoxyheptane-2,4,5-trione.
| Compound Name | 7-ethoxyheptane-2,4,5-trione |
|---|---|
| PubChem CID | 19107179 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 7-ethoxyheptane-2,4,5-trione |
| SMILES | CCOCCC(=O)C(=O)CC(C)=O |
| InChI | InChI=1S/C9H14O4/c1-3-13-5-4-8(11)9(12)6-7(2)10/h3-6H2,1-2H3 |
| InChIKey | IMINVNCOLHLJDB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|