About 7-ethoxyheptane-2,4,5-trione
7-ethoxyheptane-2,4,5-trione (PubChem CID 19107179) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-ethoxyheptane-2,4,5-trione.
Molecular Properties
| Compound Name | 7-ethoxyheptane-2,4,5-trione |
| PubChem CID | 19107179 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 7-ethoxyheptane-2,4,5-trione |
| SMILES | CCOCCC(=O)C(=O)CC(C)=O |
| InChI | InChI=1S/C9H14O4/c1-3-13-5-4-8(11)9(12)6-7(2)10/h3-6H2,1-2H3 |
| InChIKey | IMINVNCOLHLJDB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxyheptane-2,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxyheptane-2,4,5-trione?
The IUPAC name of 7-ethoxyheptane-2,4,5-trione (CID 19107179) is 7-ethoxyheptane-2,4,5-trione.
What is the SMILES notation for 7-ethoxyheptane-2,4,5-trione?
The canonical SMILES for 7-ethoxyheptane-2,4,5-trione is CCOCCC(=O)C(=O)CC(C)=O.
What is the InChIKey of 7-ethoxyheptane-2,4,5-trione?
The InChIKey is IMINVNCOLHLJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-3-13-5-4-8(11)9(12)6-7(2)10/h3-6H2,1-2H3.
What are the key properties of 7-ethoxyheptane-2,4,5-trione?
7-ethoxyheptane-2,4,5-trione has a molecular weight of 186.21 g/mol, XLogP of 0.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxyheptane-2,4,5-trione is sourced from PubChem (CID 19107179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).