C13H26N2O5 — CID 89157114
N'-[3-[2-(2-ethoxyethoxy)ethoxy]propanoyl]butanehydrazide (PubChem CID 89157114) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is N'-[3-[2-(2-ethoxyethoxy)ethoxy]propanoyl]butanehydrazide.
| Compound Name | N'-[3-[2-(2-ethoxyethoxy)ethoxy]propanoyl]butanehydrazide |
|---|---|
| PubChem CID | 89157114 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N'-[3-[2-(2-ethoxyethoxy)ethoxy]propanoyl]butanehydrazide |
| SMILES | CCCC(=O)NNC(=O)CCOCCOCCOCC |
| InChI | InChI=1S/C13H26N2O5/c1-3-5-12(16)14-15-13(17)6-7-19-10-11-20-9-8-18-4-2/h3-11H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | RBVASZVFGBDFGX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|