About 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate
2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate (PubChem CID 146640765) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate |
| PubChem CID | 146640765 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)N=C(C)CC |
| InChI | InChI=1S/C10H16N2O3/c1-4-8(3)12-10(14)11-6-7-15-9(13)5-2/h5H,2,4,6-7H2,1,3H3,(H,11,14) |
| InChIKey | QMIVPVAVGXFANJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate?
The IUPAC name of 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate (CID 146640765) is 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate.
What is the SMILES notation for 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate?
The canonical SMILES for 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate is C=CC(=O)OCCNC(=O)N=C(C)CC.
What is the InChIKey of 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate?
The InChIKey is QMIVPVAVGXFANJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-4-8(3)12-10(14)11-6-7-15-9(13)5-2/h5H,2,4,6-7H2,1,3H3,(H,11,14).
What are the key properties of 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate?
2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate has a molecular weight of 212.25 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-ylidenecarbamoylamino)ethyl prop-2-enoate is sourced from PubChem (CID 146640765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).