About butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid
butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid (PubChem CID 145345540) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid.
Molecular Properties
| Compound Name | butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid |
| PubChem CID | 145345540 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid |
| SMILES | C=CC(=O)OCCNC(=O)O.[H]/N=C(\C)CC.[H][H] |
| InChI | InChI=1S/C6H9NO4.C4H9N.H2/c1-2-5(8)11-4-3-7-6(9)10;1-3-4(2)5;/h2,7H,1,3-4H2,(H,9,10);5H,3H2,1-2H3;1H/b;5-4+; |
| InChIKey | WGLFQKVIMYPLTL-YHVJRZKVSA-N |
| XLogP | 1.67 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid?
The IUPAC name of butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid (CID 145345540) is butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid.
What is the SMILES notation for butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid?
The canonical SMILES for butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid is C=CC(=O)OCCNC(=O)O.[H]/N=C(\C)CC.[H][H].
What is the InChIKey of butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid?
The InChIKey is WGLFQKVIMYPLTL-YHVJRZKVSA-N. The full InChI is InChI=1S/C6H9NO4.C4H9N.H2/c1-2-5(8)11-4-3-7-6(9)10;1-3-4(2)5;/h2,7H,1,3-4H2,(H,9,10);5H,3H2,1-2H3;1H/b;5-4+;.
What are the key properties of butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid?
butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid has a molecular weight of 232.28 g/mol, XLogP of 1.67, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-imine;molecular hydrogen;2-prop-2-enoyloxyethylcarbamic acid is sourced from PubChem (CID 145345540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).