C29H47NO7Si2 — CID 153496127
[2-[2-[3-[[4-[dimethyl(propyl)silyl]phenyl]-dimethylsilyl]propoxy]ethoxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 153496127) has the molecular formula C29H47NO7Si2 and a molecular weight of 577.87 g/mol. Its IUPAC name is [2-[2-[3-[[4-[dimethyl(propyl)silyl]phenyl]-dimethylsilyl]propoxy]ethoxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[2-[3-[[4-[dimethyl(propyl)silyl]phenyl]-dimethylsilyl]propoxy]ethoxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 153496127 |
| Molecular Formula | C29H47NO7Si2 |
| Molecular Weight | 577.87 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | [2-[2-[3-[[4-[dimethyl(propyl)silyl]phenyl]-dimethylsilyl]propoxy]ethoxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)OCCOCCC[Si](C)(C)c1ccc([Si](C)(C)CCC)cc1 |
| InChI | InChI=1S/C29H47NO7Si2/c1-9-20-38(5,6)24-13-15-25(16-14-24)39(7,8)21-12-17-34-18-19-35-28(33)30-29(4,22-36-26(31)10-2)23-37-27(32)11-3/h10-11,13-16H,2-3,9,12,17-23H2,1,4-8H3,(H,30,33) |
| InChIKey | NFADTDYSTWIHNP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|