C22H37NO5Si2 — CID 153496123
2-[2-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propoxy]ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 153496123) has the molecular formula C22H37NO5Si2 and a molecular weight of 451.71 g/mol. Its IUPAC name is 2-[2-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propoxy]ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 153496123 |
| Molecular Formula | C22H37NO5Si2 |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-[2-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOCCC[Si](C)(C)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C22H37NO5Si2/c1-7-21(24)27-15-13-23-22(25)28-17-16-26-14-8-18-30(5,6)20-11-9-19(10-12-20)29(2,3)4/h7,9-12H,1,8,13-18H2,2-6H3,(H,23,25) |
| InChIKey | JYOIIJGZQUZIJW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|