C28H59NO3 — CID 178050067
ethane;N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4,4-tetramethyl-5-oxohexanamide;2,4,4,6-tetramethylheptane (PubChem CID 178050067) has the molecular formula C28H59NO3 and a molecular weight of 457.78 g/mol. Its IUPAC name is ethane;N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4,4-tetramethyl-5-oxohexanamide;2,4,4,6-tetramethylheptane.
| Compound Name | ethane;N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4,4-tetramethyl-5-oxohexanamide;2,4,4,6-tetramethylheptane |
|---|---|
| PubChem CID | 178050067 |
| Molecular Formula | C28H59NO3 |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.45 |
| IUPAC Name | ethane;N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4,4-tetramethyl-5-oxohexanamide;2,4,4,6-tetramethylheptane |
| SMILES | CC.CC(=O)C(C)(C)CC(C)(C)C(=O)NC(C)(C)CCO.CC(C)CC(C)(C)CC(C)C |
| InChI | InChI=1S/C15H29NO3.C11H24.C2H6/c1-11(18)13(2,3)10-14(4,5)12(19)16-15(6,7)8-9-17;1-9(2)7-11(5,6)8-10(3)4;1-2/h17H,8-10H2,1-7H3,(H,16,19);9-10H,7-8H2,1-6H3;1-2H3 |
| InChIKey | ICDBTXPPCWPGRE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |