C23H36O4S2 — CID 142135612
benzyl 5-[2-(3,3-dimethyl-5-oxopentyl)sulfanylethylsulfinyl]-3,3-dimethylpentanoate (PubChem CID 142135612) has the molecular formula C23H36O4S2 and a molecular weight of 440.67 g/mol. Its IUPAC name is benzyl 5-[2-(3,3-dimethyl-5-oxopentyl)sulfanylethylsulfinyl]-3,3-dimethylpentanoate.
| Compound Name | benzyl 5-[2-(3,3-dimethyl-5-oxopentyl)sulfanylethylsulfinyl]-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 142135612 |
| Molecular Formula | C23H36O4S2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | benzyl 5-[2-(3,3-dimethyl-5-oxopentyl)sulfanylethylsulfinyl]-3,3-dimethylpentanoate |
| SMILES | CC(C)(CC=O)CCSCCS(=O)CCC(C)(C)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H36O4S2/c1-22(2,10-13-24)11-14-28-15-17-29(26)16-12-23(3,4)18-21(25)27-19-20-8-6-5-7-9-20/h5-9,13H,10-12,14-19H2,1-4H3 |
| InChIKey | MZIGGTIWKGKFIA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|