C40H48N2O2 — CID 75182187
tert-butyl 4-[5-phenyl-4-(tritylamino)pentyl]piperidine-1-carboxylate (PubChem CID 75182187) has the molecular formula C40H48N2O2 and a molecular weight of 588.84 g/mol. Its IUPAC name is tert-butyl 4-[5-phenyl-4-(tritylamino)pentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-phenyl-4-(tritylamino)pentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75182187 |
| Molecular Formula | C40H48N2O2 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | tert-butyl 4-[5-phenyl-4-(tritylamino)pentyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCC(Cc2ccccc2)NC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C40H48N2O2/c1-39(2,3)44-38(43)42-29-27-32(28-30-42)19-16-26-37(31-33-17-8-4-9-18-33)41-40(34-20-10-5-11-21-34,35-22-12-6-13-23-35)36-24-14-7-15-25-36/h4-15,17-18,20-25,32,37,41H,16,19,26-31H2,1-3H3 |
| InChIKey | CSWLPTKGAKKGMI-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|