C9H13N5OP+ — CID 58602324
pyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium (PubChem CID 58602324) has the molecular formula C9H13N5OP+ and a molecular weight of 238.21 g/mol. Its IUPAC name is pyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium.
| Compound Name | pyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium |
|---|---|
| PubChem CID | 58602324 |
| Molecular Formula | C9H13N5OP+ |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | pyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium |
| SMILES | c1cnc2c(c1)nnn2O[PH2+]N1CCCC1 |
| InChI | InChI=1S/C9H12N5OP/c1-2-7-13(6-1)16-15-14-9-8(11-12-14)4-3-5-10-9/h3-5,16H,1-2,6-7H2/p+1 |
| InChIKey | XOGCQENHDJBLFN-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|