C10H17F6N6OP — CID 162327826
dimethylamino-dimethyl-(triazolo[4,5-b]pyridin-3-yloxymethyl)azanium hexafluorophosphate (PubChem CID 162327826) has the molecular formula C10H17F6N6OP and a molecular weight of 382.25 g/mol. Its IUPAC name is dimethylamino-dimethyl-(triazolo[4,5-b]pyridin-3-yloxymethyl)azanium hexafluorophosphate.
| Compound Name | dimethylamino-dimethyl-(triazolo[4,5-b]pyridin-3-yloxymethyl)azanium hexafluorophosphate |
|---|---|
| PubChem CID | 162327826 |
| Molecular Formula | C10H17F6N6OP |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | dimethylamino-dimethyl-(triazolo[4,5-b]pyridin-3-yloxymethyl)azanium hexafluorophosphate |
| SMILES | CN(C)[N+](C)(C)COn1nnc2cccnc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H17N6O.F6P/c1-14(2)16(3,4)8-17-15-10-9(12-13-15)6-5-7-11-10;1-7(2,3,4,5)6/h5-7H,8H2,1-4H3;/q+1;-1 |
| InChIKey | XTWDDLWUOZYDCC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|