C12H9ClN4 — CID 117159368
3-[(4-chlorophenyl)methyl]triazolo[4,5-b]pyridine (PubChem CID 117159368) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]triazolo[4,5-b]pyridine.
| Compound Name | 3-[(4-chlorophenyl)methyl]triazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117159368 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]triazolo[4,5-b]pyridine |
| SMILES | Clc1ccc(Cn2nnc3cccnc32)cc1 |
| InChI | InChI=1S/C12H9ClN4/c13-10-5-3-9(4-6-10)8-17-12-11(15-16-17)2-1-7-14-12/h1-7H,8H2 |
| InChIKey | UDJJILYGZLQVQA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |