C22H32N10O6S — CID 162236049
bis([benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium);sulfate (PubChem CID 162236049) has the molecular formula C22H32N10O6S and a molecular weight of 564.63 g/mol. Its IUPAC name is bis([benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium);sulfate.
| Compound Name | bis([benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium);sulfate |
|---|---|
| PubChem CID | 162236049 |
| Molecular Formula | C22H32N10O6S |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | bis([benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium);sulfate |
| SMILES | CN(C)C(On1nnc2ccccc21)=[N+](C)C.CN(C)C(On1nnc2ccccc21)=[N+](C)C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C11H16N5O.H2O4S/c2*1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;1-5(2,3)4/h2*5-8H,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | DXPBRWJPGBSMSC-UHFFFAOYSA-L |
| XLogP | -1.24 |
| TPSA | 172.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|