C12H7F3N4 — CID 13359275
3-[4-(trifluoromethyl)phenyl]triazolo[4,5-b]pyridine (PubChem CID 13359275) has the molecular formula C12H7F3N4 and a molecular weight of 264.21 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]triazolo[4,5-b]pyridine.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]triazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 13359275 |
| Molecular Formula | C12H7F3N4 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]triazolo[4,5-b]pyridine |
| SMILES | FC(F)(F)c1ccc(-n2nnc3cccnc32)cc1 |
| InChI | InChI=1S/C12H7F3N4/c13-12(14,15)8-3-5-9(6-4-8)19-11-10(17-18-19)2-1-7-16-11/h1-7H |
| InChIKey | PLWPGZVMLSEOQA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |