C19H15N5OS — CID 53067517
N-(3-methylsulfanylphenyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide (PubChem CID 53067517) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide.
| Compound Name | N-(3-methylsulfanylphenyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 53067517 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2ccc(-n3nnc4cccnc43)cc2)c1 |
| InChI | InChI=1S/C19H15N5OS/c1-26-16-5-2-4-14(12-16)21-19(25)13-7-9-15(10-8-13)24-18-17(22-23-24)6-3-11-20-18/h2-12H,1H3,(H,21,25) |
| InChIKey | TYKPLAMPFRKIIZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |