C24H18ClN3O2S2 — CID 46323762
4-[3-(4-chlorophenyl)sulfanyl-6-oxopyridazin-1-yl]-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 46323762) has the molecular formula C24H18ClN3O2S2 and a molecular weight of 480.01 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)sulfanyl-6-oxopyridazin-1-yl]-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 4-[3-(4-chlorophenyl)sulfanyl-6-oxopyridazin-1-yl]-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 46323762 |
| Molecular Formula | C24H18ClN3O2S2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 4-[3-(4-chlorophenyl)sulfanyl-6-oxopyridazin-1-yl]-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2ccc(-n3nc(Sc4ccc(Cl)cc4)ccc3=O)cc2)c1 |
| InChI | InChI=1S/C24H18ClN3O2S2/c1-31-21-4-2-3-18(15-21)26-24(30)16-5-9-19(10-6-16)28-23(29)14-13-22(27-28)32-20-11-7-17(25)8-12-20/h2-15H,1H3,(H,26,30) |
| InChIKey | QEHBGZPTCLEWAO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |