C24H18FN3O2S — CID 46323826
N-(2-fluorophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide (PubChem CID 46323826) has the molecular formula C24H18FN3O2S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide.
| Compound Name | N-(2-fluorophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide |
|---|---|
| PubChem CID | 46323826 |
| Molecular Formula | C24H18FN3O2S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-(2-fluorophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide |
| SMILES | Cc1ccc(Sc2ccc(=O)n(-c3ccc(C(=O)Nc4ccccc4F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H18FN3O2S/c1-16-6-12-19(13-7-16)31-22-14-15-23(29)28(27-22)18-10-8-17(9-11-18)24(30)26-21-5-3-2-4-20(21)25/h2-15H,1H3,(H,26,30) |
| InChIKey | CUSLZDIIBWLFFA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |