C25H21N3O3S — CID 46323807
N-(4-methoxyphenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide (PubChem CID 46323807) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide.
| Compound Name | N-(4-methoxyphenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide |
|---|---|
| PubChem CID | 46323807 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-n3nc(Sc4ccc(C)cc4)ccc3=O)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-17-3-13-22(14-4-17)32-23-15-16-24(29)28(27-23)20-9-5-18(6-10-20)25(30)26-19-7-11-21(31-2)12-8-19/h3-16H,1-2H3,(H,26,30) |
| InChIKey | XXZSJDXMNIXDOT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |