C24H18BrN3O2S — CID 46323885
N-(4-bromophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide (PubChem CID 46323885) has the molecular formula C24H18BrN3O2S and a molecular weight of 492.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide.
| Compound Name | N-(4-bromophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide |
|---|---|
| PubChem CID | 46323885 |
| Molecular Formula | C24H18BrN3O2S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | N-(4-bromophenyl)-4-[3-(4-methylphenyl)sulfanyl-6-oxopyridazin-1-yl]benzamide |
| SMILES | Cc1ccc(Sc2ccc(=O)n(-c3ccc(C(=O)Nc4ccc(Br)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H18BrN3O2S/c1-16-2-12-21(13-3-16)31-22-14-15-23(29)28(27-22)20-10-4-17(5-11-20)24(30)26-19-8-6-18(25)7-9-19/h2-15H,1H3,(H,26,30) |
| InChIKey | UCZYPOITOOYYSG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |