C15H21N3O2S — CID 117160904
4-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-2-yl]thiane 1,1-dioxide (PubChem CID 117160904) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-2-yl]thiane 1,1-dioxide.
| Compound Name | 4-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-2-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117160904 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-2-yl]thiane 1,1-dioxide |
| SMILES | CC(C)Cn1c(C2CCS(=O)(=O)CC2)nc2cccnc21 |
| InChI | InChI=1S/C15H21N3O2S/c1-11(2)10-18-14(12-5-8-21(19,20)9-6-12)17-13-4-3-7-16-15(13)18/h3-4,7,11-12H,5-6,8-10H2,1-2H3 |
| InChIKey | BAONLNGTXWXAHX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |