C12H14ClN3OS — CID 113480268
4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1-oxide (PubChem CID 113480268) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1-oxide.
| Compound Name | 4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1-oxide |
|---|---|
| PubChem CID | 113480268 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1-oxide |
| SMILES | O=S1CCC(n2c(CCl)nc3cccnc32)CC1 |
| InChI | InChI=1S/C12H14ClN3OS/c13-8-11-15-10-2-1-5-14-12(10)16(11)9-3-6-18(17)7-4-9/h1-2,5,9H,3-4,6-8H2 |
| InChIKey | IMDXEIUAJWHKHF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|