C12H13BrClN3O2S — CID 79301919
3-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide (PubChem CID 79301919) has the molecular formula C12H13BrClN3O2S and a molecular weight of 378.68 g/mol. Its IUPAC name is 3-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide.
| Compound Name | 3-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 79301919 |
| Molecular Formula | C12H13BrClN3O2S |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 3-[6-bromo-2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(n2c(CCl)nc3cc(Br)cnc32)C1 |
| InChI | InChI=1S/C12H13BrClN3O2S/c13-8-4-10-12(15-6-8)17(11(5-14)16-10)9-2-1-3-20(18,19)7-9/h4,6,9H,1-3,5,7H2 |
| InChIKey | BPVSMJLNGVTESF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|