C14H17BrClN3 — CID 79302450
6-bromo-2-(chloromethyl)-3-(2-methylcyclohexyl)imidazo[4,5-b]pyridine (PubChem CID 79302450) has the molecular formula C14H17BrClN3 and a molecular weight of 342.67 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-3-(2-methylcyclohexyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(chloromethyl)-3-(2-methylcyclohexyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79302450 |
| Molecular Formula | C14H17BrClN3 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-3-(2-methylcyclohexyl)imidazo[4,5-b]pyridine |
| SMILES | CC1CCCCC1n1c(CCl)nc2cc(Br)cnc21 |
| InChI | InChI=1S/C14H17BrClN3/c1-9-4-2-3-5-12(9)19-13(7-16)18-11-6-10(15)8-17-14(11)19/h6,8-9,12H,2-5,7H2,1H3 |
| InChIKey | QAWFRKDLQDMKGE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|