C15H18BrClN4 — CID 79280056
3-(1-azabicyclo[2.2.2]octan-3-yl)-6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridine (PubChem CID 79280056) has the molecular formula C15H18BrClN4 and a molecular weight of 369.69 g/mol. Its IUPAC name is 3-(1-azabicyclo[2.2.2]octan-3-yl)-6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(1-azabicyclo[2.2.2]octan-3-yl)-6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79280056 |
| Molecular Formula | C15H18BrClN4 |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 3-(1-azabicyclo[2.2.2]octan-3-yl)-6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCCc1nc2cc(Br)cnc2n1C1CN2CCC1CC2 |
| InChI | InChI=1S/C15H18BrClN4/c16-11-7-12-15(18-8-11)21(14(19-12)1-4-17)13-9-20-5-2-10(13)3-6-20/h7-8,10,13H,1-6,9H2 |
| InChIKey | UNRVQJOARFIJCF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|