C14H18ClN3O2S — CID 81140787
3-[2-(1-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide (PubChem CID 81140787) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 3-[2-(1-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide.
| Compound Name | 3-[2-(1-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 81140787 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[2-(1-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
| SMILES | Cc1ccc2nc(C(C)Cl)n(C3CCCS(=O)(=O)C3)c2n1 |
| InChI | InChI=1S/C14H18ClN3O2S/c1-9-5-6-12-14(16-9)18(13(17-12)10(2)15)11-4-3-7-21(19,20)8-11/h5-6,10-11H,3-4,7-8H2,1-2H3 |
| InChIKey | YOOGTVUDFYHXLR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|