C12H15N3O2S — CID 115552160
1-(1,1-dioxothiolan-3-yl)-7-methylbenzimidazol-2-amine (PubChem CID 115552160) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-7-methylbenzimidazol-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-7-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 115552160 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-7-methylbenzimidazol-2-amine |
| SMILES | Cc1cccc2nc(N)n(C3CCS(=O)(=O)C3)c12 |
| InChI | InChI=1S/C12H15N3O2S/c1-8-3-2-4-10-11(8)15(12(13)14-10)9-5-6-18(16,17)7-9/h2-4,9H,5-7H2,1H3,(H2,13,14) |
| InChIKey | WMTGVYKKHVURDJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |