C18H25NO6S — CID 126491762
4-O-[2-(tert-butylsulfonylamino)-3-phenylpropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 126491762) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-O-[2-(tert-butylsulfonylamino)-3-phenylpropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-(tert-butylsulfonylamino)-3-phenylpropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126491762 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-O-[2-(tert-butylsulfonylamino)-3-phenylpropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(Cc1ccccc1)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C18H25NO6S/c1-18(2,3)26(22,23)19-15(12-14-8-6-5-7-9-14)13-25-17(21)11-10-16(20)24-4/h5-11,15,19H,12-13H2,1-4H3/b11-10+ |
| InChIKey | WHHNPAGBJKJRCE-ZHACJKMWSA-N |
| XLogP | 1.59 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|