C14H18F3NO4S — CID 154713833
methyl 6-phenyl-5-(trifluoromethylsulfonylamino)hexanoate (PubChem CID 154713833) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is methyl 6-phenyl-5-(trifluoromethylsulfonylamino)hexanoate.
| Compound Name | methyl 6-phenyl-5-(trifluoromethylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 154713833 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl 6-phenyl-5-(trifluoromethylsulfonylamino)hexanoate |
| SMILES | COC(=O)CCCC(Cc1ccccc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO4S/c1-22-13(19)9-5-8-12(10-11-6-3-2-4-7-11)18-23(20,21)14(15,16)17/h2-4,6-7,12,18H,5,8-10H2,1H3 |
| InChIKey | JRWCMQAUQXRCBP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |