C15H23NO6S2 — CID 96527775
methyl (3R)-3-(3-methylsulfonylpropylsulfonylamino)-4-phenylbutanoate (PubChem CID 96527775) has the molecular formula C15H23NO6S2 and a molecular weight of 377.48 g/mol. Its IUPAC name is methyl (3R)-3-(3-methylsulfonylpropylsulfonylamino)-4-phenylbutanoate.
| Compound Name | methyl (3R)-3-(3-methylsulfonylpropylsulfonylamino)-4-phenylbutanoate |
|---|---|
| PubChem CID | 96527775 |
| Molecular Formula | C15H23NO6S2 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | methyl (3R)-3-(3-methylsulfonylpropylsulfonylamino)-4-phenylbutanoate |
| SMILES | COC(=O)C[C@@H](Cc1ccccc1)NS(=O)(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C15H23NO6S2/c1-22-15(17)12-14(11-13-7-4-3-5-8-13)16-24(20,21)10-6-9-23(2,18)19/h3-5,7-8,14,16H,6,9-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | LZKYIVOAILXZER-CQSZACIVSA-N |
| XLogP | 0.51 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |