C12H17NO5S — CID 63261722
3-[(1-hydroxy-3-phenylpropan-2-yl)sulfamoyl]propanoic acid (PubChem CID 63261722) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[(1-hydroxy-3-phenylpropan-2-yl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(1-hydroxy-3-phenylpropan-2-yl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 63261722 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-[(1-hydroxy-3-phenylpropan-2-yl)sulfamoyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO5S/c14-9-11(8-10-4-2-1-3-5-10)13-19(17,18)7-6-12(15)16/h1-5,11,13-14H,6-9H2,(H,15,16) |
| InChIKey | JKMIULCZNABPDZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |