C9H14N2O3S — CID 104923639
[(2R)-3-hydroxy-2-(sulfamoylamino)propyl]benzene (PubChem CID 104923639) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is [(2R)-3-hydroxy-2-(sulfamoylamino)propyl]benzene.
| Compound Name | [(2R)-3-hydroxy-2-(sulfamoylamino)propyl]benzene |
|---|---|
| PubChem CID | 104923639 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [(2R)-3-hydroxy-2-(sulfamoylamino)propyl]benzene |
| SMILES | NS(=O)(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C9H14N2O3S/c10-15(13,14)11-9(7-12)6-8-4-2-1-3-5-8/h1-5,9,11-12H,6-7H2,(H2,10,13,14)/t9-/m1/s1 |
| InChIKey | QFXCDACLSRWVTF-SECBINFHSA-N |
| XLogP | -0.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |