C15H18N2O3S — CID 63260686
2-[(1-hydroxy-3-phenylpropan-2-yl)amino]benzenesulfonamide (PubChem CID 63260686) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-phenylpropan-2-yl)amino]benzenesulfonamide.
| Compound Name | 2-[(1-hydroxy-3-phenylpropan-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 63260686 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[(1-hydroxy-3-phenylpropan-2-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O3S/c16-21(19,20)15-9-5-4-8-14(15)17-13(11-18)10-12-6-2-1-3-7-12/h1-9,13,17-18H,10-11H2,(H2,16,19,20) |
| InChIKey | FKZMICNNRSTYMM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |