C14H16N2O — CID 55169769
3-phenyl-2-(pyridin-4-ylamino)propan-1-ol (PubChem CID 55169769) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-phenyl-2-(pyridin-4-ylamino)propan-1-ol.
| Compound Name | 3-phenyl-2-(pyridin-4-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 55169769 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-phenyl-2-(pyridin-4-ylamino)propan-1-ol |
| SMILES | OCC(Cc1ccccc1)Nc1ccncc1 |
| InChI | InChI=1S/C14H16N2O/c17-11-14(10-12-4-2-1-3-5-12)16-13-6-8-15-9-7-13/h1-9,14,17H,10-11H2,(H,15,16) |
| InChIKey | FEGPGBAHPNSLNZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |