C16H16ClN3O3 — CID 51824206
N-(2-chloro-4-pyridinyl)-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide (PubChem CID 51824206) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 51824206 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-N'-[(2R)-1-hydroxy-3-phenylpropan-2-yl]oxamide |
| SMILES | O=C(Nc1ccnc(Cl)c1)C(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O3/c17-14-9-12(6-7-18-14)19-15(22)16(23)20-13(10-21)8-11-4-2-1-3-5-11/h1-7,9,13,21H,8,10H2,(H,20,23)(H,18,19,22)/t13-/m1/s1 |
| InChIKey | GIWGCHANOXXMAC-CYBMUJFWSA-N |
| XLogP | 1.39 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|