C13H19NO4S — CID 43361780
3-(4-phenylbutan-2-ylsulfamoyl)propanoic acid (PubChem CID 43361780) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-(4-phenylbutan-2-ylsulfamoyl)propanoic acid.
| Compound Name | 3-(4-phenylbutan-2-ylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 43361780 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-(4-phenylbutan-2-ylsulfamoyl)propanoic acid |
| SMILES | CC(CCc1ccccc1)NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C13H19NO4S/c1-11(7-8-12-5-3-2-4-6-12)14-19(17,18)10-9-13(15)16/h2-6,11,14H,7-10H2,1H3,(H,15,16) |
| InChIKey | ZVADROOSSOWETI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |