C14H21NO3 — CID 55169386
methyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]butanoate (PubChem CID 55169386) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]butanoate.
| Compound Name | methyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]butanoate |
|---|---|
| PubChem CID | 55169386 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | methyl 4-[(1-hydroxy-3-phenylpropan-2-yl)amino]butanoate |
| SMILES | COC(=O)CCCNC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-18-14(17)8-5-9-15-13(11-16)10-12-6-3-2-4-7-12/h2-4,6-7,13,15-16H,5,8-11H2,1H3 |
| InChIKey | XNOSDDTWGDCUTP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|