C17H27ClN2O3 — CID 70402985
methyl 7-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]heptanoate;hydrochloride (PubChem CID 70402985) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is methyl 7-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]heptanoate;hydrochloride.
| Compound Name | methyl 7-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]heptanoate;hydrochloride |
|---|---|
| PubChem CID | 70402985 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl 7-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]heptanoate;hydrochloride |
| SMILES | COC(=O)CCCCCCN[C@@H](Cc1ccccc1)C(N)=O.Cl |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-22-16(20)11-7-2-3-8-12-19-15(17(18)21)13-14-9-5-4-6-10-14;/h4-6,9-10,15,19H,2-3,7-8,11-13H2,1H3,(H2,18,21);1H/t15-;/m0./s1 |
| InChIKey | VUPICTXWVJAKLG-RSAXXLAASA-N |
| XLogP | 2.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|