C21H32N2O5 — CID 54072959
methyl 6-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-3-phenylpropan-2-yl]amino]hexanoate (PubChem CID 54072959) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-3-phenylpropan-2-yl]amino]hexanoate.
| Compound Name | methyl 6-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-3-phenylpropan-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 54072959 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | methyl 6-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-3-phenylpropan-2-yl]amino]hexanoate |
| SMILES | COC(=O)CCCCCN[C@@H](Cc1ccccc1)C(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O5/c1-21(2,3)28-20(26)23-19(25)17(15-16-11-7-5-8-12-16)22-14-10-6-9-13-18(24)27-4/h5,7-8,11-12,17,22H,6,9-10,13-15H2,1-4H3,(H,23,25,26)/t17-/m0/s1 |
| InChIKey | MHTIORDAYITWDK-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|