C21H29NO5 — CID 91354533
methyl (8S)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-9-phenylnon-5-enoate (PubChem CID 91354533) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl (8S)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-9-phenylnon-5-enoate.
| Compound Name | methyl (8S)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-9-phenylnon-5-enoate |
|---|---|
| PubChem CID | 91354533 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | methyl (8S)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-9-phenylnon-5-enoate |
| SMILES | COC(=O)CCCC=CC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29NO5/c1-21(2,3)27-20(25)22-17(15-16-11-7-5-8-12-16)18(23)13-9-6-10-14-19(24)26-4/h5,7-9,11-13,17H,6,10,14-15H2,1-4H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | OEIVFOGVGIYHBL-KRWDZBQOSA-N |
| XLogP | 3.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|