C27H34N2O5 — CID 57413999
benzyl N-[(E,7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-8-phenyloct-4-enyl]carbamate (PubChem CID 57413999) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is benzyl N-[(E,7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-8-phenyloct-4-enyl]carbamate.
| Compound Name | benzyl N-[(E,7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-8-phenyloct-4-enyl]carbamate |
|---|---|
| PubChem CID | 57413999 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | benzyl N-[(E,7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-8-phenyloct-4-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)/C=C/CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O5/c1-27(2,3)34-26(32)29-23(19-21-13-7-4-8-14-21)24(30)17-11-6-12-18-28-25(31)33-20-22-15-9-5-10-16-22/h4-5,7-11,13-17,23H,6,12,18-20H2,1-3H3,(H,28,31)(H,29,32)/b17-11+/t23-/m0/s1 |
| InChIKey | XLXGPLFELFBXDJ-HZUJZGFBSA-N |
| XLogP | 4.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|