C13H18N2O — CID 67567715
2-(2-methylprop-2-enylamino)-3-phenylpropanamide (PubChem CID 67567715) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)-3-phenylpropanamide.
| Compound Name | 2-(2-methylprop-2-enylamino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 67567715 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)-3-phenylpropanamide |
| SMILES | C=C(C)CNC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C13H18N2O/c1-10(2)9-15-12(13(14)16)8-11-6-4-3-5-7-11/h3-7,12,15H,1,8-9H2,2H3,(H2,14,16) |
| InChIKey | DCVZKODANGNCTR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|