C12H17N2OY- — CID 59021356
(2S)-3-phenyl-2-(propylamino)propanamide;yttrium (PubChem CID 59021356) has the molecular formula C12H17N2OY- and a molecular weight of 294.19 g/mol. Its IUPAC name is (2S)-3-phenyl-2-(propylamino)propanamide;yttrium.
| Compound Name | (2S)-3-phenyl-2-(propylamino)propanamide;yttrium |
|---|---|
| PubChem CID | 59021356 |
| Molecular Formula | C12H17N2OY- |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (2S)-3-phenyl-2-(propylamino)propanamide;yttrium |
| SMILES | [CH2-]CCN[C@@H](Cc1ccccc1)C(N)=O.[Y] |
| InChI | InChI=1S/C12H17N2O.Y/c1-2-8-14-11(12(13)15)9-10-6-4-3-5-7-10;/h3-7,11,14H,1-2,8-9H2,(H2,13,15);/q-1;/t11-;/m0./s1 |
| InChIKey | UYJBJMOWOIWYPZ-MERQFXBCSA-N |
| XLogP | 0.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|