C21H27NO5S — CID 123256147
methyl 4-[[1-hydroxy-3-[4-(4-methylsulfonylphenyl)phenyl]propan-2-yl]amino]butanoate (PubChem CID 123256147) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is methyl 4-[[1-hydroxy-3-[4-(4-methylsulfonylphenyl)phenyl]propan-2-yl]amino]butanoate.
| Compound Name | methyl 4-[[1-hydroxy-3-[4-(4-methylsulfonylphenyl)phenyl]propan-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 123256147 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 4-[[1-hydroxy-3-[4-(4-methylsulfonylphenyl)phenyl]propan-2-yl]amino]butanoate |
| SMILES | COC(=O)CCCNC(CO)Cc1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-27-21(24)4-3-13-22-19(15-23)14-16-5-7-17(8-6-16)18-9-11-20(12-10-18)28(2,25)26/h5-12,19,22-23H,3-4,13-15H2,1-2H3 |
| InChIKey | NURGTLUYYHXUBP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|